Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Allyltrimethylsilane, 98+%
CAS: 762-72-1 Molecular Formula: C6H14Si Molecular Weight (g/mol): 114.263 MDL Number: MFCD00008635 InChI Key: HYWCXWRMUZYRPH-UHFFFAOYSA-N Synonym: allyltrimethylsilane,silane, trimethyl-2-propenyl,trimethylallylsilane,silane, allyltrimethyl,allyl trimethylsilane,unii-8b84c337vf,ccris 2649,allyl trimethyl silane,3-trimethylsilyl propene,allytrimethylsilane PubChem CID: 69808 IUPAC Name: trimethyl(prop-2-enyl)silane SMILES: C[Si](C)(C)CC=C
| PubChem CID | 69808 |
|---|---|
| CAS | 762-72-1 |
| Molecular Weight (g/mol) | 114.263 |
| MDL Number | MFCD00008635 |
| SMILES | C[Si](C)(C)CC=C |
| Synonym | allyltrimethylsilane,silane, trimethyl-2-propenyl,trimethylallylsilane,silane, allyltrimethyl,allyl trimethylsilane,unii-8b84c337vf,ccris 2649,allyl trimethyl silane,3-trimethylsilyl propene,allytrimethylsilane |
| IUPAC Name | trimethyl(prop-2-enyl)silane |
| InChI Key | HYWCXWRMUZYRPH-UHFFFAOYSA-N |
| Molecular Formula | C6H14Si |
1-(Trimethylsiloxy)cyclohexene, 98%
CAS: 6651-36-1 Molecular Formula: C9H18OSi Molecular Weight (g/mol): 170.33 MDL Number: MFCD00001541 InChI Key: SBEMOANGDSSPJY-UHFFFAOYSA-N Synonym: 1-trimethylsilyloxy cyclohexene,cyclohex-1-en-1-yloxy trimethylsilane,1-trimethylsiloxy cyclohexene,silane, 1-cyclohexen-1-yloxy trimethyl,1-cyclohexenyloxytrimethylsilane,1-cyclohexen-1-yloxy trimethylsilane,cyclohexene, 1-trimethylsilyl oxy,cyclohexenyloxy trimethylsilane,1-trimethylsiloxycyclohexene,cyclohexenyloxytrimethylsilane PubChem CID: 81161 IUPAC Name: cyclohexen-1-yloxy(trimethyl)silane SMILES: C[Si](C)(C)OC1=CCCCC1
| PubChem CID | 81161 |
|---|---|
| CAS | 6651-36-1 |
| Molecular Weight (g/mol) | 170.33 |
| MDL Number | MFCD00001541 |
| SMILES | C[Si](C)(C)OC1=CCCCC1 |
| Synonym | 1-trimethylsilyloxy cyclohexene,cyclohex-1-en-1-yloxy trimethylsilane,1-trimethylsiloxy cyclohexene,silane, 1-cyclohexen-1-yloxy trimethyl,1-cyclohexenyloxytrimethylsilane,1-cyclohexen-1-yloxy trimethylsilane,cyclohexene, 1-trimethylsilyl oxy,cyclohexenyloxy trimethylsilane,1-trimethylsiloxycyclohexene,cyclohexenyloxytrimethylsilane |
| IUPAC Name | cyclohexen-1-yloxy(trimethyl)silane |
| InChI Key | SBEMOANGDSSPJY-UHFFFAOYSA-N |
| Molecular Formula | C9H18OSi |
Copper foil, 1.27mm (0.05in) thick, 99.9% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Copper slug, 6.35mm (0.25 in.) dia. x 6.35mm (0.25 in.) length, Puratronic™, 99.9999% (metals basis), Thermo Scientific Chemicals
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Copper wire, 0.5mm (0.02in) dia, Puratronic™, 99.9999% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Antimony(III) sulfide, 99.999% (metals basis)
CAS: 1345-04-6 Molecular Formula: S3Sb2 Molecular Weight (g/mol): 339.70 MDL Number: MFCD00011217 InChI Key: NVWBARWTDVQPJD-UHFFFAOYSA-N IUPAC Name: diantimony(3+) trisulfanediide SMILES: [S--].[S--].[S--].[Sb+3].[Sb+3]
| CAS | 1345-04-6 |
|---|---|
| Molecular Weight (g/mol) | 339.70 |
| MDL Number | MFCD00011217 |
| SMILES | [S--].[S--].[S--].[Sb+3].[Sb+3] |
| IUPAC Name | diantimony(3+) trisulfanediide |
| InChI Key | NVWBARWTDVQPJD-UHFFFAOYSA-N |
| Molecular Formula | S3Sb2 |
Boron carbide, 90+%
CAS: 12069-32-8 Molecular Formula: CB4 Molecular Weight (g/mol): 55.25 MDL Number: MFCD00011520 InChI Key: INAHAJYZKVIDIZ-UHFFFAOYSA-N Synonym: boron carbide,boron carbide b4c,tetra 10b boron carbide,boron carbide, dust,tetrabor,boron carbide powder,boron carbide b4c grade hp,boron carbide b4c grade hs,b4-c,boron carbide b4c grade hd 07 PubChem CID: 123279 IUPAC Name: 2,3,4,5-tetraboratetracyclo[2.1.0.0¹,³.0²,⁵]pentane SMILES: B12B3B4B1C234
| PubChem CID | 123279 |
|---|---|
| CAS | 12069-32-8 |
| Molecular Weight (g/mol) | 55.25 |
| MDL Number | MFCD00011520 |
| SMILES | B12B3B4B1C234 |
| Synonym | boron carbide,boron carbide b4c,tetra 10b boron carbide,boron carbide, dust,tetrabor,boron carbide powder,boron carbide b4c grade hp,boron carbide b4c grade hs,b4-c,boron carbide b4c grade hd 07 |
| IUPAC Name | 2,3,4,5-tetraboratetracyclo[2.1.0.0¹,³.0²,⁵]pentane |
| InChI Key | INAHAJYZKVIDIZ-UHFFFAOYSA-N |
| Molecular Formula | CB4 |
Dimethylphenylsilane, 97%
CAS: 766-77-8 Molecular Formula: C8H11Si Molecular Weight (g/mol): 135.261 MDL Number: MFCD00008257 InChI Key: OIKHZBFJHONJJB-UHFFFAOYSA-N Synonym: dimethylphenylsilane,dimethyl phenyl silane,phenyldimethylsilane,silane, dimethylphenyl,benzene, dimethylsilyl,dimethylphenyl silane,c8h12si,dimethyl phenyl silyl,dimethyl-phenylsilicon PubChem CID: 6327656 IUPAC Name: dimethyl(phenyl)silicon SMILES: C[Si](C)C1=CC=CC=C1
| PubChem CID | 6327656 |
|---|---|
| CAS | 766-77-8 |
| Molecular Weight (g/mol) | 135.261 |
| MDL Number | MFCD00008257 |
| SMILES | C[Si](C)C1=CC=CC=C1 |
| Synonym | dimethylphenylsilane,dimethyl phenyl silane,phenyldimethylsilane,silane, dimethylphenyl,benzene, dimethylsilyl,dimethylphenyl silane,c8h12si,dimethyl phenyl silyl,dimethyl-phenylsilicon |
| IUPAC Name | dimethyl(phenyl)silicon |
| InChI Key | OIKHZBFJHONJJB-UHFFFAOYSA-N |
| Molecular Formula | C8H11Si |
Bis(trimethylsilyl)methane, 98%
CAS: 2117-28-4 Molecular Formula: C7H20Si2 Molecular Weight (g/mol): 160.41 MDL Number: MFCD00008275 InChI Key: GYIODRUWWNNGPI-UHFFFAOYSA-N Synonym: bis trimethylsilyl methane,methylenebis trimethylsilane,silane, methylenebis trimethyl,trimethyl trimethylsilylmethyl silane,trimethyl trimethylsilyl methyl silane,2,4-disilapentane, 2,2,4,4-tetramethyl,silane, 1,1'-methylenebis 1,1,1-trimethyl PubChem CID: 75029 IUPAC Name: trimethyl(trimethylsilylmethyl)silane SMILES: C[Si](C)(C)C[Si](C)(C)C
| PubChem CID | 75029 |
|---|---|
| CAS | 2117-28-4 |
| Molecular Weight (g/mol) | 160.41 |
| MDL Number | MFCD00008275 |
| SMILES | C[Si](C)(C)C[Si](C)(C)C |
| Synonym | bis trimethylsilyl methane,methylenebis trimethylsilane,silane, methylenebis trimethyl,trimethyl trimethylsilylmethyl silane,trimethyl trimethylsilyl methyl silane,2,4-disilapentane, 2,2,4,4-tetramethyl,silane, 1,1'-methylenebis 1,1,1-trimethyl |
| IUPAC Name | trimethyl(trimethylsilylmethyl)silane |
| InChI Key | GYIODRUWWNNGPI-UHFFFAOYSA-N |
| Molecular Formula | C7H20Si2 |
1-Chloro-5-triethylsilyl-4-pentyne, 97%
CAS: 174125-30-5 Molecular Formula: C11H21ClSi Molecular Weight (g/mol): 216.82 MDL Number: MFCD00671352 InChI Key: YOFYXFCOGXKCGG-UHFFFAOYSA-N Synonym: 1-chloro-5-triethylsilyl-4-pentyne,5-chloropent-1-ynyl triethyl silane,5-chloropent-1-ynyl triethylsilane,1-triethylsilyl-5-chloro-1-pentyne,5-chloranylpent-1-ynyl triethyl silane,5-chloropent-1-yn-1-yl triethylsilane,5-chloropent-1-yn-1-yl triethyl silane,silane, 5-chloro-1-pentyn-1-yl triethyl PubChem CID: 2757930 IUPAC Name: 5-chloropent-1-ynyl(triethyl)silane SMILES: CC[Si](CC)(CC)C#CCCCCl
| PubChem CID | 2757930 |
|---|---|
| CAS | 174125-30-5 |
| Molecular Weight (g/mol) | 216.82 |
| MDL Number | MFCD00671352 |
| SMILES | CC[Si](CC)(CC)C#CCCCCl |
| Synonym | 1-chloro-5-triethylsilyl-4-pentyne,5-chloropent-1-ynyl triethyl silane,5-chloropent-1-ynyl triethylsilane,1-triethylsilyl-5-chloro-1-pentyne,5-chloranylpent-1-ynyl triethyl silane,5-chloropent-1-yn-1-yl triethylsilane,5-chloropent-1-yn-1-yl triethyl silane,silane, 5-chloro-1-pentyn-1-yl triethyl |
| IUPAC Name | 5-chloropent-1-ynyl(triethyl)silane |
| InChI Key | YOFYXFCOGXKCGG-UHFFFAOYSA-N |
| Molecular Formula | C11H21ClSi |
Boron tribromide, 99% min
CAS: 10294-33-4 Molecular Formula: BBr3 Molecular Weight (g/mol): 250.52 MDL Number: MFCD00011312 InChI Key: ILAHWRKJUDSMFH-UHFFFAOYSA-N Synonym: boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide PubChem CID: 25134 IUPAC Name: tribromoborane SMILES: BrB(Br)Br
| PubChem CID | 25134 |
|---|---|
| CAS | 10294-33-4 |
| Molecular Weight (g/mol) | 250.52 |
| MDL Number | MFCD00011312 |
| SMILES | BrB(Br)Br |
| Synonym | boron tribromide,borane, tribromo,boron bromide,tribromoboron,hsdb 327,tribromoboran,boron tribrornide,boron tri bromide,boron tri-bromide |
| IUPAC Name | tribromoborane |
| InChI Key | ILAHWRKJUDSMFH-UHFFFAOYSA-N |
| Molecular Formula | BBr3 |
| CAS | 2550-02-9 |
|---|---|
| MDL Number | MFCD00026756 |
Silicon, +12 Mesh to 1 in., Lump, 96%75, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7440-21-3
| CAS | 7440-21-3 |
|---|
3-(Methacryloyloxy)propyltris(trimethylsiloxy)silane, 98%
CAS: 17096-07-0 Molecular Formula: C16H38O5Si4 Molecular Weight (g/mol): 422.815 MDL Number: MFCD00053871 InChI Key: BESKSSIEODQWBP-UHFFFAOYSA-N Synonym: 3-methacryloyloxy propyltris trimethylsiloxy silane,3-tris trimethylsiloxy silyl propyl methacrylate,3-1,1,1,5,5,5-hexamethyl-3-trimethylsilyl oxy trisiloxan-3-yl propyl methacrylate,unii-d32s78j7t8,3-methacryloyloxypropyl tris trimethylsiloxy silane,3-methacryloxypropyltris trimethylsiloxy silane,3-tris trimethylsilyloxy silyl propyl methacrylate,methacryloxypropyltris trimethylsiloxy silane,3-3,3,3-trimethyl-1,1-bis trimethylsilyl oxy disiloxanyl propyl methacrylate PubChem CID: 123371 IUPAC Name: 3-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C
| PubChem CID | 123371 |
|---|---|
| CAS | 17096-07-0 |
| Molecular Weight (g/mol) | 422.815 |
| MDL Number | MFCD00053871 |
| SMILES | CC(=C)C(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| Synonym | 3-methacryloyloxy propyltris trimethylsiloxy silane,3-tris trimethylsiloxy silyl propyl methacrylate,3-1,1,1,5,5,5-hexamethyl-3-trimethylsilyl oxy trisiloxan-3-yl propyl methacrylate,unii-d32s78j7t8,3-methacryloyloxypropyl tris trimethylsiloxy silane,3-methacryloxypropyltris trimethylsiloxy silane,3-tris trimethylsilyloxy silyl propyl methacrylate,methacryloxypropyltris trimethylsiloxy silane,3-3,3,3-trimethyl-1,1-bis trimethylsilyl oxy disiloxanyl propyl methacrylate |
| IUPAC Name | 3-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate |
| InChI Key | BESKSSIEODQWBP-UHFFFAOYSA-N |
| Molecular Formula | C16H38O5Si4 |
Antimony(III) oxide, 99.9% (metals basis)
CAS: 1309-64-4 Molecular Formula: O3Sb2 Molecular Weight (g/mol): 291.52 MDL Number: MFCD00011214 InChI Key: GHPGOEFPKIHBNM-UHFFFAOYSA-N IUPAC Name: diantimony(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Sb+3].[Sb+3]
| CAS | 1309-64-4 |
|---|---|
| Molecular Weight (g/mol) | 291.52 |
| MDL Number | MFCD00011214 |
| SMILES | [O--].[O--].[O--].[Sb+3].[Sb+3] |
| IUPAC Name | diantimony(3+) trioxidandiide |
| InChI Key | GHPGOEFPKIHBNM-UHFFFAOYSA-N |
| Molecular Formula | O3Sb2 |